ChemNet > CAS > 26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
상품명칭 |
2-[(4-chlorophenyl)thio]-3-nitropyridine |
영문 이름 |
2-[(4-chlorophenyl)thio]-3-nitropyridine;2-[(4-chlorophenyl)sulfanyl]-3-nitropyridine |
분자식 |
C11H7ClN2O2S |
분자량 |
266.7035 |
InChI |
InChI=1/C11H7ClN2O2S/c12-8-3-5-9(6-4-8)17-11-10(14(15)16)2-1-7-13-11/h1-7H |
cas번호 |
26820-31-5 |
분자 구조 |
|
밀도 |
1.47g/cm3 |
녹는 점 |
127℃ |
비등점 |
398.4°C at 760 mmHg |
굴절 지수 |
1.68 |
인화점 |
194.8°C |
증기압 |
3.39E-06mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|